About 3-acetylpyrrolidin-2-one
3-acetylpyrrolidin-2-one (PubChem CID 23009872) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 3-acetylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-acetylpyrrolidin-2-one |
| PubChem CID | 23009872 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 3-acetylpyrrolidin-2-one |
| SMILES | CC(=O)C1CCNC1=O |
| InChI | InChI=1S/C6H9NO2/c1-4(8)5-2-3-7-6(5)9/h5H,2-3H2,1H3,(H,7,9) |
| InChIKey | SGKFHKSMOYYRDF-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-acetylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetylpyrrolidin-2-one?
The IUPAC name of 3-acetylpyrrolidin-2-one (CID 23009872) is 3-acetylpyrrolidin-2-one.
What is the SMILES notation for 3-acetylpyrrolidin-2-one?
The canonical SMILES for 3-acetylpyrrolidin-2-one is CC(=O)C1CCNC1=O.
What is the InChIKey of 3-acetylpyrrolidin-2-one?
The InChIKey is SGKFHKSMOYYRDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-4(8)5-2-3-7-6(5)9/h5H,2-3H2,1H3,(H,7,9).
What are the key properties of 3-acetylpyrrolidin-2-one?
3-acetylpyrrolidin-2-one has a molecular weight of 127.14 g/mol, XLogP of -0.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetylpyrrolidin-2-one is sourced from PubChem (CID 23009872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).