C24H30Cl2N2O2 — CID 23010647
N,N'-bis(3-chloro-4-methylphenyl)decanediamide (PubChem CID 23010647) has the molecular formula C24H30Cl2N2O2 and a molecular weight of 449.42 g/mol. Its IUPAC name is N,N'-bis(3-chloro-4-methylphenyl)decanediamide.
| Compound Name | N,N'-bis(3-chloro-4-methylphenyl)decanediamide |
|---|---|
| PubChem CID | 23010647 |
| Molecular Formula | C24H30Cl2N2O2 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N,N'-bis(3-chloro-4-methylphenyl)decanediamide |
| SMILES | Cc1ccc(NC(=O)CCCCCCCCC(=O)Nc2ccc(C)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C24H30Cl2N2O2/c1-17-11-13-19(15-21(17)25)27-23(29)9-7-5-3-4-6-8-10-24(30)28-20-14-12-18(2)22(26)16-20/h11-16H,3-10H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | PEUKPPCXYGXLDD-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|