C19H12N6O3 — CID 2301095
2,3-bis(furan-2-yl)-N-(1H-1,2,4-triazol-5-yl)quinoxaline-6-carboxamide (PubChem CID 2301095) has the molecular formula C19H12N6O3 and a molecular weight of 372.34 g/mol. Its IUPAC name is 2,3-bis(furan-2-yl)-N-(1H-1,2,4-triazol-5-yl)quinoxaline-6-carboxamide.
| Compound Name | 2,3-bis(furan-2-yl)-N-(1H-1,2,4-triazol-5-yl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 2301095 |
| Molecular Formula | C19H12N6O3 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2,3-bis(furan-2-yl)-N-(1H-1,2,4-triazol-5-yl)quinoxaline-6-carboxamide |
| SMILES | O=C(Nc1ncn[nH]1)c1ccc2nc(-c3ccco3)c(-c3ccco3)nc2c1 |
| InChI | InChI=1S/C19H12N6O3/c26-18(24-19-20-10-21-25-19)11-5-6-12-13(9-11)23-17(15-4-2-8-28-15)16(22-12)14-3-1-7-27-14/h1-10H,(H2,20,21,24,25,26) |
| InChIKey | BRKVOUCHUZVUQX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |