(3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate

C16H14Cl2O3 — CID 23011363

IUPAC(3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate
SMILESCCOc1ccccc1C(=O)Oc1cc(Cl)c(C)c(Cl)c1
InChIInChI=1S/C16H14Cl2O3/c1-3-20-15-7-5-4-6-12(15)16(19)21-11-8-13(17)10(2)14(18)9-11/h4-9H,3H2,1-2H3
InChIKeyVPJAYNSQNWKOJW-UHFFFAOYSA-N
MW325.19 g/mol
LogP4.92
Rot. Bonds4

About (3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate

(3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate (PubChem CID 23011363) has the molecular formula C16H14Cl2O3 and a molecular weight of 325.19 g/mol. Its IUPAC name is (3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate.

Molecular Properties

Compound Name(3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate
PubChem CID23011363
Molecular FormulaC16H14Cl2O3
Molecular Weight325.19 g/mol
Exact Mass324.03
IUPAC Name(3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate
SMILESCCOc1ccccc1C(=O)Oc1cc(Cl)c(C)c(Cl)c1
InChIInChI=1S/C16H14Cl2O3/c1-3-20-15-7-5-4-6-12(15)16(19)21-11-8-13(17)10(2)14(18)9-11/h4-9H,3H2,1-2H3
InChIKeyVPJAYNSQNWKOJW-UHFFFAOYSA-N
XLogP4.92
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.19
LogP ≤ 54.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate?
The IUPAC name of (3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate (CID 23011363) is (3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate.
What is the SMILES notation for (3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate?
The canonical SMILES for (3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate is CCOc1ccccc1C(=O)Oc1cc(Cl)c(C)c(Cl)c1.
What is the InChIKey of (3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate?
The InChIKey is VPJAYNSQNWKOJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2O3/c1-3-20-15-7-5-4-6-12(15)16(19)21-11-8-13(17)10(2)14(18)9-11/h4-9H,3H2,1-2H3.
What are the key properties of (3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate?
(3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate has a molecular weight of 325.19 g/mol, XLogP of 4.92, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dichloro-4-methylphenyl) 2-ethoxybenzoate is sourced from PubChem (CID 23011363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).