C19H21NO5 — CID 23011425
(3-nitrophenyl) 4-hexoxybenzoate (PubChem CID 23011425) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is (3-nitrophenyl) 4-hexoxybenzoate.
| Compound Name | (3-nitrophenyl) 4-hexoxybenzoate |
|---|---|
| PubChem CID | 23011425 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (3-nitrophenyl) 4-hexoxybenzoate |
| SMILES | CCCCCCOc1ccc(C(=O)Oc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H21NO5/c1-2-3-4-5-13-24-17-11-9-15(10-12-17)19(21)25-18-8-6-7-16(14-18)20(22)23/h6-12,14H,2-5,13H2,1H3 |
| InChIKey | OBRFTOJGXJUMLT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|