C22H15BrCl2O4 — CID 23013347
(2,4-dichloro-6-formylphenyl) 3-bromo-4-(2-phenylethoxy)benzoate (PubChem CID 23013347) has the molecular formula C22H15BrCl2O4 and a molecular weight of 494.17 g/mol. Its IUPAC name is (2,4-dichloro-6-formylphenyl) 3-bromo-4-(2-phenylethoxy)benzoate.
| Compound Name | (2,4-dichloro-6-formylphenyl) 3-bromo-4-(2-phenylethoxy)benzoate |
|---|---|
| PubChem CID | 23013347 |
| Molecular Formula | C22H15BrCl2O4 |
| Molecular Weight | 494.17 g/mol |
| Exact Mass | 491.95 |
| IUPAC Name | (2,4-dichloro-6-formylphenyl) 3-bromo-4-(2-phenylethoxy)benzoate |
| SMILES | O=Cc1cc(Cl)cc(Cl)c1OC(=O)c1ccc(OCCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C22H15BrCl2O4/c23-18-11-15(6-7-20(18)28-9-8-14-4-2-1-3-5-14)22(27)29-21-16(13-26)10-17(24)12-19(21)25/h1-7,10-13H,8-9H2 |
| InChIKey | HDYUQSXEODKZJA-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.17 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|