About 6-chloro-3-(2,3-difluorophenoxy)-1H-pyridazin-4-one
6-chloro-3-(2,3-difluorophenoxy)-1H-pyridazin-4-one (PubChem CID 23013934) has the molecular formula C10H5ClF2N2O2
and a molecular weight of 258.61 g/mol. Its IUPAC name is 6-chloro-3-(2,3-difluorophenoxy)-1H-pyridazin-4-one.
Molecular Properties
| Compound Name | 6-chloro-3-(2,3-difluorophenoxy)-1H-pyridazin-4-one |
| PubChem CID | 23013934 |
| Molecular Formula | C10H5ClF2N2O2 |
| Molecular Weight | 258.61 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 6-chloro-3-(2,3-difluorophenoxy)-1H-pyridazin-4-one |
| SMILES | O=c1cc(Cl)[nH]nc1Oc1cccc(F)c1F |
| InChI | InChI=1S/C10H5ClF2N2O2/c11-8-4-6(16)10(15-14-8)17-7-3-1-2-5(12)9(7)13/h1-4H,(H,14,16) |
| InChIKey | VDOSZHZGWHLKBP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.61 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-3-(2,3-difluorophenoxy)-1H-pyridazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-(2,3-difluorophenoxy)-1H-pyridazin-4-one?
The IUPAC name of 6-chloro-3-(2,3-difluorophenoxy)-1H-pyridazin-4-one (CID 23013934) is 6-chloro-3-(2,3-difluorophenoxy)-1H-pyridazin-4-one.
What is the SMILES notation for 6-chloro-3-(2,3-difluorophenoxy)-1H-pyridazin-4-one?
The canonical SMILES for 6-chloro-3-(2,3-difluorophenoxy)-1H-pyridazin-4-one is O=c1cc(Cl)[nH]nc1Oc1cccc(F)c1F.
What is the InChIKey of 6-chloro-3-(2,3-difluorophenoxy)-1H-pyridazin-4-one?
The InChIKey is VDOSZHZGWHLKBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClF2N2O2/c11-8-4-6(16)10(15-14-8)17-7-3-1-2-5(12)9(7)13/h1-4H,(H,14,16).
What are the key properties of 6-chloro-3-(2,3-difluorophenoxy)-1H-pyridazin-4-one?
6-chloro-3-(2,3-difluorophenoxy)-1H-pyridazin-4-one has a molecular weight of 258.61 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-(2,3-difluorophenoxy)-1H-pyridazin-4-one is sourced from PubChem (CID 23013934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).