About (2-butoxyphenyl)methanol
(2-butoxyphenyl)methanol (PubChem CID 23014) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is (2-butoxyphenyl)methanol.
Molecular Properties
| Compound Name | (2-butoxyphenyl)methanol |
| PubChem CID | 23014 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (2-butoxyphenyl)methanol |
| SMILES | CCCCOc1ccccc1CO |
| InChI | InChI=1S/C11H16O2/c1-2-3-8-13-11-7-5-4-6-10(11)9-12/h4-7,12H,2-3,8-9H2,1H3 |
| InChIKey | XHMKGDUAGDFSHL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-butoxyphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-butoxyphenyl)methanol?
The IUPAC name of (2-butoxyphenyl)methanol (CID 23014) is (2-butoxyphenyl)methanol.
What is the SMILES notation for (2-butoxyphenyl)methanol?
The canonical SMILES for (2-butoxyphenyl)methanol is CCCCOc1ccccc1CO.
What is the InChIKey of (2-butoxyphenyl)methanol?
The InChIKey is XHMKGDUAGDFSHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-2-3-8-13-11-7-5-4-6-10(11)9-12/h4-7,12H,2-3,8-9H2,1H3.
What are the key properties of (2-butoxyphenyl)methanol?
(2-butoxyphenyl)methanol has a molecular weight of 180.25 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-butoxyphenyl)methanol is sourced from PubChem (CID 23014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).