C24H31N5OS2 — CID 23014481
4-[2-[1-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperidin-4-yl]-1,3-thiazol-4-yl]benzonitrile (PubChem CID 23014481) has the molecular formula C24H31N5OS2 and a molecular weight of 469.68 g/mol. Its IUPAC name is 4-[2-[1-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperidin-4-yl]-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[2-[1-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperidin-4-yl]-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 23014481 |
| Molecular Formula | C24H31N5OS2 |
| Molecular Weight | 469.68 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 4-[2-[1-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperidin-4-yl]-1,3-thiazol-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2csc(C3CCN(CCCCC(N)C(=O)N4CCSC4)CC3)n2)cc1 |
| InChI | InChI=1S/C24H31N5OS2/c25-15-18-4-6-19(7-5-18)22-16-32-23(27-22)20-8-11-28(12-9-20)10-2-1-3-21(26)24(30)29-13-14-31-17-29/h4-7,16,20-21H,1-3,8-14,17,26H2 |
| InChIKey | MEAPWRQMTGFRLF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.68 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|