C26H25N — CID 23015340
N-phenyl-1-[2-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)naphthalen-1-yl]methanimine (PubChem CID 23015340) has the molecular formula C26H25N and a molecular weight of 351.49 g/mol. Its IUPAC name is N-phenyl-1-[2-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)naphthalen-1-yl]methanimine.
| Compound Name | N-phenyl-1-[2-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)naphthalen-1-yl]methanimine |
|---|---|
| PubChem CID | 23015340 |
| Molecular Formula | C26H25N |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | N-phenyl-1-[2-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)naphthalen-1-yl]methanimine |
| SMILES | CC1=C(C)C(C)C(c2ccc3ccccc3c2/C=N/c2ccccc2)=C1C |
| InChI | InChI=1S/C26H25N/c1-17-18(2)20(4)26(19(17)3)24-15-14-21-10-8-9-13-23(21)25(24)16-27-22-11-6-5-7-12-22/h5-16,19H,1-4H3/b27-16+ |
| InChIKey | UWXSGQILSKPHJR-JVWAILMASA-N |
| XLogP | 7.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|