C20H27N — CID 23015400
N-tert-butyl-1-[2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanimine (PubChem CID 23015400) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is N-tert-butyl-1-[2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanimine.
| Compound Name | N-tert-butyl-1-[2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanimine |
|---|---|
| PubChem CID | 23015400 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | N-tert-butyl-1-[2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)phenyl]ethanimine |
| SMILES | CC1=CC(C)C(c2ccccc2/C(C)=N/C(C)(C)C)=C1C |
| InChI | InChI=1S/C20H27N/c1-13-12-14(2)19(15(13)3)18-11-9-8-10-17(18)16(4)21-20(5,6)7/h8-12,14H,1-7H3/b21-16+ |
| InChIKey | BCBWWESWJHPDDY-LTGZKZEYSA-N |
| XLogP | 5.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|