About N-[(E)-[2-(9H-fluoren-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline
N-[(E)-[2-(9H-fluoren-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline (PubChem CID 23015876) has the molecular formula C29H26N2
and a molecular weight of 402.54 g/mol. Its IUPAC name is N-[(E)-[2-(9H-fluoren-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline.
Molecular Properties
| Compound Name | N-[(E)-[2-(9H-fluoren-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline |
| PubChem CID | 23015876 |
| Molecular Formula | C29H26N2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-[(E)-[2-(9H-fluoren-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(N/N=C/c2ccccc2-c2cccc3c2Cc2ccccc2-3)c(C)c1 |
| InChI | InChI=1S/C29H26N2/c1-19-15-20(2)29(21(3)16-19)31-30-18-23-10-5-7-12-25(23)27-14-8-13-26-24-11-6-4-9-22(24)17-28(26)27/h4-16,18,31H,17H2,1-3H3/b30-18+ |
| InChIKey | HRKUZNYAUTVGRN-UXHLAJHPSA-N |
| XLogP | 7.30 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-[2-(9H-fluoren-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-[2-(9H-fluoren-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline?
The IUPAC name of N-[(E)-[2-(9H-fluoren-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline (CID 23015876) is N-[(E)-[2-(9H-fluoren-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline.
What is the SMILES notation for N-[(E)-[2-(9H-fluoren-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline?
The canonical SMILES for N-[(E)-[2-(9H-fluoren-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline is Cc1cc(C)c(N/N=C/c2ccccc2-c2cccc3c2Cc2ccccc2-3)c(C)c1.
What is the InChIKey of N-[(E)-[2-(9H-fluoren-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline?
The InChIKey is HRKUZNYAUTVGRN-UXHLAJHPSA-N. The full InChI is InChI=1S/C29H26N2/c1-19-15-20(2)29(21(3)16-19)31-30-18-23-10-5-7-12-25(23)27-14-8-13-26-24-11-6-4-9-22(24)17-28(26)27/h4-16,18,31H,17H2,1-3H3/b30-18+.
What are the key properties of N-[(E)-[2-(9H-fluoren-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline?
N-[(E)-[2-(9H-fluoren-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline has a molecular weight of 402.54 g/mol, XLogP of 7.30, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-[2-(9H-fluoren-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline is sourced from PubChem (CID 23015876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).