About 2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)benzonitrile
2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)benzonitrile (PubChem CID 23016068) has the molecular formula C15H15N
and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)benzonitrile |
| PubChem CID | 23016068 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)benzonitrile |
| SMILES | CC1=CC(C)C(c2ccccc2C#N)=C1C |
| InChI | InChI=1S/C15H15N/c1-10-8-11(2)15(12(10)3)14-7-5-4-6-13(14)9-16/h4-8,11H,1-3H3 |
| InChIKey | CVNPVTOYXWHVLY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)benzonitrile?
The IUPAC name of 2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)benzonitrile (CID 23016068) is 2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)benzonitrile.
What is the SMILES notation for 2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)benzonitrile?
The canonical SMILES for 2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)benzonitrile is CC1=CC(C)C(c2ccccc2C#N)=C1C.
What is the InChIKey of 2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)benzonitrile?
The InChIKey is CVNPVTOYXWHVLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N/c1-10-8-11(2)15(12(10)3)14-7-5-4-6-13(14)9-16/h4-8,11H,1-3H3.
What are the key properties of 2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)benzonitrile?
2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)benzonitrile has a molecular weight of 209.29 g/mol, XLogP of 3.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3,5-trimethylcyclopenta-1,3-dien-1-yl)benzonitrile is sourced from PubChem (CID 23016068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).