About N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]benzamide
N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]benzamide (PubChem CID 2301646) has the molecular formula C22H14Cl2N2OS2
and a molecular weight of 457.41 g/mol. Its IUPAC name is N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]benzamide.
Molecular Properties
| Compound Name | N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]benzamide |
| PubChem CID | 2301646 |
| Molecular Formula | C22H14Cl2N2OS2 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]benzamide |
| SMILES | N#CC(NC(=O)c1ccccc1)=C(Sc1ccc(Cl)cc1)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H14Cl2N2OS2/c23-16-6-10-18(11-7-16)28-22(29-19-12-8-17(24)9-13-19)20(14-25)26-21(27)15-4-2-1-3-5-15/h1-13H,(H,26,27) |
| InChIKey | KQFNUXMSDFMQFG-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]benzamide?
The IUPAC name of N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]benzamide (CID 2301646) is N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]benzamide.
What is the SMILES notation for N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]benzamide?
The canonical SMILES for N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]benzamide is N#CC(NC(=O)c1ccccc1)=C(Sc1ccc(Cl)cc1)Sc1ccc(Cl)cc1.
What is the InChIKey of N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]benzamide?
The InChIKey is KQFNUXMSDFMQFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14Cl2N2OS2/c23-16-6-10-18(11-7-16)28-22(29-19-12-8-17(24)9-13-19)20(14-25)26-21(27)15-4-2-1-3-5-15/h1-13H,(H,26,27).
What are the key properties of N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]benzamide?
N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]benzamide has a molecular weight of 457.41 g/mol, XLogP of 7.00, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2-bis[(4-chlorophenyl)sulfanyl]-1-cyanoethenyl]benzamide is sourced from PubChem (CID 2301646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).