About 6-aminohexan-1-ol;3-nitro-N-(6-piperidin-1-ylhexyl)pyridin-2-amine
6-aminohexan-1-ol;3-nitro-N-(6-piperidin-1-ylhexyl)pyridin-2-amine (PubChem CID 23016516) has the molecular formula C22H41N5O3
and a molecular weight of 423.60 g/mol. Its IUPAC name is 6-aminohexan-1-ol;3-nitro-N-(6-piperidin-1-ylhexyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 6-aminohexan-1-ol;3-nitro-N-(6-piperidin-1-ylhexyl)pyridin-2-amine |
| PubChem CID | 23016516 |
| Molecular Formula | C22H41N5O3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.32 |
| IUPAC Name | 6-aminohexan-1-ol;3-nitro-N-(6-piperidin-1-ylhexyl)pyridin-2-amine |
| SMILES | NCCCCCCO.O=[N+]([O-])c1cccnc1NCCCCCCN1CCCCC1 |
| InChI | InChI=1S/C16H26N4O2.C6H15NO/c21-20(22)15-9-8-11-18-16(15)17-10-4-1-2-5-12-19-13-6-3-7-14-19;7-5-3-1-2-4-6-8/h8-9,11H,1-7,10,12-14H2,(H,17,18);8H,1-7H2 |
| InChIKey | OBMWANWHHSOAEW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 117.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-aminohexan-1-ol;3-nitro-N-(6-piperidin-1-ylhexyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-aminohexan-1-ol;3-nitro-N-(6-piperidin-1-ylhexyl)pyridin-2-amine?
The IUPAC name of 6-aminohexan-1-ol;3-nitro-N-(6-piperidin-1-ylhexyl)pyridin-2-amine (CID 23016516) is 6-aminohexan-1-ol;3-nitro-N-(6-piperidin-1-ylhexyl)pyridin-2-amine.
What is the SMILES notation for 6-aminohexan-1-ol;3-nitro-N-(6-piperidin-1-ylhexyl)pyridin-2-amine?
The canonical SMILES for 6-aminohexan-1-ol;3-nitro-N-(6-piperidin-1-ylhexyl)pyridin-2-amine is NCCCCCCO.O=[N+]([O-])c1cccnc1NCCCCCCN1CCCCC1.
What is the InChIKey of 6-aminohexan-1-ol;3-nitro-N-(6-piperidin-1-ylhexyl)pyridin-2-amine?
The InChIKey is OBMWANWHHSOAEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O2.C6H15NO/c21-20(22)15-9-8-11-18-16(15)17-10-4-1-2-5-12-19-13-6-3-7-14-19;7-5-3-1-2-4-6-8/h8-9,11H,1-7,10,12-14H2,(H,17,18);8H,1-7H2.
What are the key properties of 6-aminohexan-1-ol;3-nitro-N-(6-piperidin-1-ylhexyl)pyridin-2-amine?
6-aminohexan-1-ol;3-nitro-N-(6-piperidin-1-ylhexyl)pyridin-2-amine has a molecular weight of 423.60 g/mol, XLogP of 3.95, 14 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-aminohexan-1-ol;3-nitro-N-(6-piperidin-1-ylhexyl)pyridin-2-amine is sourced from PubChem (CID 23016516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).