C29H45NO — CID 23016534
6-phenylhexan-1-ol;1-(6-phenylhexyl)piperidine (PubChem CID 23016534) has the molecular formula C29H45NO and a molecular weight of 423.69 g/mol. Its IUPAC name is 6-phenylhexan-1-ol;1-(6-phenylhexyl)piperidine.
| Compound Name | 6-phenylhexan-1-ol;1-(6-phenylhexyl)piperidine |
|---|---|
| PubChem CID | 23016534 |
| Molecular Formula | C29H45NO |
| Molecular Weight | 423.69 g/mol |
| Exact Mass | 423.35 |
| IUPAC Name | 6-phenylhexan-1-ol;1-(6-phenylhexyl)piperidine |
| SMILES | OCCCCCCc1ccccc1.c1ccc(CCCCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C17H27N.C12H18O/c1(5-11-17-12-6-3-7-13-17)2-8-14-18-15-9-4-10-16-18;13-11-7-2-1-4-8-12-9-5-3-6-10-12/h3,6-7,12-13H,1-2,4-5,8-11,14-16H2;3,5-6,9-10,13H,1-2,4,7-8,11H2 |
| InChIKey | VZWMORCGKQRZOB-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.69 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|