About 1-iodo-2,3-bis(trifluoromethylsulfonyl)benzene
1-iodo-2,3-bis(trifluoromethylsulfonyl)benzene (PubChem CID 23016671) has the molecular formula C8H3F6IO4S2
and a molecular weight of 468.13 g/mol. Its IUPAC name is 1-iodo-2,3-bis(trifluoromethylsulfonyl)benzene.
Molecular Properties
| Compound Name | 1-iodo-2,3-bis(trifluoromethylsulfonyl)benzene |
| PubChem CID | 23016671 |
| Molecular Formula | C8H3F6IO4S2 |
| Molecular Weight | 468.13 g/mol |
| Exact Mass | 467.84 |
| IUPAC Name | 1-iodo-2,3-bis(trifluoromethylsulfonyl)benzene |
| SMILES | O=S(=O)(c1cccc(I)c1S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H3F6IO4S2/c9-7(10,11)20(16,17)5-3-1-2-4(15)6(5)21(18,19)8(12,13)14/h1-3H |
| InChIKey | SDNZPOJRHRQXLZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.13 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-2,3-bis(trifluoromethylsulfonyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-2,3-bis(trifluoromethylsulfonyl)benzene?
The IUPAC name of 1-iodo-2,3-bis(trifluoromethylsulfonyl)benzene (CID 23016671) is 1-iodo-2,3-bis(trifluoromethylsulfonyl)benzene.
What is the SMILES notation for 1-iodo-2,3-bis(trifluoromethylsulfonyl)benzene?
The canonical SMILES for 1-iodo-2,3-bis(trifluoromethylsulfonyl)benzene is O=S(=O)(c1cccc(I)c1S(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of 1-iodo-2,3-bis(trifluoromethylsulfonyl)benzene?
The InChIKey is SDNZPOJRHRQXLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F6IO4S2/c9-7(10,11)20(16,17)5-3-1-2-4(15)6(5)21(18,19)8(12,13)14/h1-3H.
What are the key properties of 1-iodo-2,3-bis(trifluoromethylsulfonyl)benzene?
1-iodo-2,3-bis(trifluoromethylsulfonyl)benzene has a molecular weight of 468.13 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-2,3-bis(trifluoromethylsulfonyl)benzene is sourced from PubChem (CID 23016671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).