C12H24N2O4 — CID 2301708
(2R,3R)-N,N'-dibutyl-2,3-dihydroxybutanediamide (PubChem CID 2301708) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is (2R,3R)-N,N'-dibutyl-2,3-dihydroxybutanediamide.
| Compound Name | (2R,3R)-N,N'-dibutyl-2,3-dihydroxybutanediamide |
|---|---|
| PubChem CID | 2301708 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | (2R,3R)-N,N'-dibutyl-2,3-dihydroxybutanediamide |
| SMILES | CCCCNC(=O)[C@H](O)[C@@H](O)C(=O)NCCCC |
| InChI | InChI=1S/C12H24N2O4/c1-3-5-7-13-11(17)9(15)10(16)12(18)14-8-6-4-2/h9-10,15-16H,3-8H2,1-2H3,(H,13,17)(H,14,18)/t9-,10-/m1/s1 |
| InChIKey | XSSKMPGASXYIDJ-NXEZZACHSA-N |
| XLogP | -0.46 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|