About benzo[cd]indol-2-amine
benzo[cd]indol-2-amine (PubChem CID 2301724) has the molecular formula C11H8N2
and a molecular weight of 168.20 g/mol. Its IUPAC name is benzo[cd]indol-2-amine.
Molecular Properties
| Compound Name | benzo[cd]indol-2-amine |
| PubChem CID | 2301724 |
| Molecular Formula | C11H8N2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | benzo[cd]indol-2-amine |
| SMILES | NC1=Nc2cccc3cccc1c23 |
| InChI | InChI=1S/C11H8N2/c12-11-8-5-1-3-7-4-2-6-9(13-11)10(7)8/h1-6H,(H2,12,13) |
| InChIKey | SAFJOJPQROXNBY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzo[cd]indol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[cd]indol-2-amine?
The IUPAC name of benzo[cd]indol-2-amine (CID 2301724) is benzo[cd]indol-2-amine.
What is the SMILES notation for benzo[cd]indol-2-amine?
The canonical SMILES for benzo[cd]indol-2-amine is NC1=Nc2cccc3cccc1c23.
What is the InChIKey of benzo[cd]indol-2-amine?
The InChIKey is SAFJOJPQROXNBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2/c12-11-8-5-1-3-7-4-2-6-9(13-11)10(7)8/h1-6H,(H2,12,13).
What are the key properties of benzo[cd]indol-2-amine?
benzo[cd]indol-2-amine has a molecular weight of 168.20 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[cd]indol-2-amine is sourced from PubChem (CID 2301724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).