C28H31NO5 — CID 23017687
3-[2-[(3-hydroxy-3-methyl-1-phenylbutyl)carbamoyl]-4-(phenoxymethyl)phenyl]propanoic acid (PubChem CID 23017687) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is 3-[2-[(3-hydroxy-3-methyl-1-phenylbutyl)carbamoyl]-4-(phenoxymethyl)phenyl]propanoic acid.
| Compound Name | 3-[2-[(3-hydroxy-3-methyl-1-phenylbutyl)carbamoyl]-4-(phenoxymethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 23017687 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 3-[2-[(3-hydroxy-3-methyl-1-phenylbutyl)carbamoyl]-4-(phenoxymethyl)phenyl]propanoic acid |
| SMILES | CC(C)(O)CC(NC(=O)c1cc(COc2ccccc2)ccc1CCC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C28H31NO5/c1-28(2,33)18-25(22-9-5-3-6-10-22)29-27(32)24-17-20(13-14-21(24)15-16-26(30)31)19-34-23-11-7-4-8-12-23/h3-14,17,25,33H,15-16,18-19H2,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | XLEYZHTVSAIJHV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |