C28H32Cl2N2O3Si — CID 23018608
N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)butyl]-3-cyano-2-hydroxynaphthalene-1-carboxamide (PubChem CID 23018608) has the molecular formula C28H32Cl2N2O3Si and a molecular weight of 543.57 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)butyl]-3-cyano-2-hydroxynaphthalene-1-carboxamide.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)butyl]-3-cyano-2-hydroxynaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 23018608 |
| Molecular Formula | C28H32Cl2N2O3Si |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)butyl]-3-cyano-2-hydroxynaphthalene-1-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(CNC(=O)c1c(O)c(C#N)cc2ccccc12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H32Cl2N2O3Si/c1-28(2,3)36(4,5)35-13-12-20(18-10-11-23(29)24(30)15-18)17-32-27(34)25-22-9-7-6-8-19(22)14-21(16-31)26(25)33/h6-11,14-15,20,33H,12-13,17H2,1-5H3,(H,32,34) |
| InChIKey | KGXJLPSCVKIDKK-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|