C20H24N3O2+ — CID 2301934
4-methyl-N-[3-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]benzamide (PubChem CID 2301934) has the molecular formula C20H24N3O2+ and a molecular weight of 338.43 g/mol. Its IUPAC name is 4-methyl-N-[3-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]benzamide.
| Compound Name | 4-methyl-N-[3-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2301934 |
| Molecular Formula | C20H24N3O2+ |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 4-methyl-N-[3-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C(=O)N3CC[NH+](C)CC3)c2)cc1 |
| InChI | InChI=1S/C20H23N3O2/c1-15-6-8-16(9-7-15)19(24)21-18-5-3-4-17(14-18)20(25)23-12-10-22(2)11-13-23/h3-9,14H,10-13H2,1-2H3,(H,21,24)/p+1 |
| InChIKey | LAPDLARAEKBKTO-UHFFFAOYSA-O |
| XLogP | 1.22 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |