About 1-iodoethyl cyclopentanecarboxylate
1-iodoethyl cyclopentanecarboxylate (PubChem CID 23019514) has the molecular formula C8H13IO2
and a molecular weight of 268.09 g/mol. Its IUPAC name is 1-iodoethyl cyclopentanecarboxylate.
Molecular Properties
| Compound Name | 1-iodoethyl cyclopentanecarboxylate |
| PubChem CID | 23019514 |
| Molecular Formula | C8H13IO2 |
| Molecular Weight | 268.09 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 1-iodoethyl cyclopentanecarboxylate |
| SMILES | CC(I)OC(=O)C1CCCC1 |
| InChI | InChI=1S/C8H13IO2/c1-6(9)11-8(10)7-4-2-3-5-7/h6-7H,2-5H2,1H3 |
| InChIKey | CTBCRFJJWQNUBG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.09 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodoethyl cyclopentanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodoethyl cyclopentanecarboxylate?
The IUPAC name of 1-iodoethyl cyclopentanecarboxylate (CID 23019514) is 1-iodoethyl cyclopentanecarboxylate.
What is the SMILES notation for 1-iodoethyl cyclopentanecarboxylate?
The canonical SMILES for 1-iodoethyl cyclopentanecarboxylate is CC(I)OC(=O)C1CCCC1.
What is the InChIKey of 1-iodoethyl cyclopentanecarboxylate?
The InChIKey is CTBCRFJJWQNUBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13IO2/c1-6(9)11-8(10)7-4-2-3-5-7/h6-7H,2-5H2,1H3.
What are the key properties of 1-iodoethyl cyclopentanecarboxylate?
1-iodoethyl cyclopentanecarboxylate has a molecular weight of 268.09 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodoethyl cyclopentanecarboxylate is sourced from PubChem (CID 23019514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).