About 4-(5-benzyltetrazol-1-yl)-2,5-dimethoxyaniline
4-(5-benzyltetrazol-1-yl)-2,5-dimethoxyaniline (PubChem CID 23019981) has the molecular formula C16H17N5O2
and a molecular weight of 311.35 g/mol. Its IUPAC name is 4-(5-benzyltetrazol-1-yl)-2,5-dimethoxyaniline.
Molecular Properties
| Compound Name | 4-(5-benzyltetrazol-1-yl)-2,5-dimethoxyaniline |
| PubChem CID | 23019981 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 4-(5-benzyltetrazol-1-yl)-2,5-dimethoxyaniline |
| SMILES | COc1cc(-n2nnnc2Cc2ccccc2)c(OC)cc1N |
| InChI | InChI=1S/C16H17N5O2/c1-22-14-10-13(15(23-2)9-12(14)17)21-16(18-19-20-21)8-11-6-4-3-5-7-11/h3-7,9-10H,8,17H2,1-2H3 |
| InChIKey | PXPDDOVLMCYUFP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-benzyltetrazol-1-yl)-2,5-dimethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-benzyltetrazol-1-yl)-2,5-dimethoxyaniline?
The IUPAC name of 4-(5-benzyltetrazol-1-yl)-2,5-dimethoxyaniline (CID 23019981) is 4-(5-benzyltetrazol-1-yl)-2,5-dimethoxyaniline.
What is the SMILES notation for 4-(5-benzyltetrazol-1-yl)-2,5-dimethoxyaniline?
The canonical SMILES for 4-(5-benzyltetrazol-1-yl)-2,5-dimethoxyaniline is COc1cc(-n2nnnc2Cc2ccccc2)c(OC)cc1N.
What is the InChIKey of 4-(5-benzyltetrazol-1-yl)-2,5-dimethoxyaniline?
The InChIKey is PXPDDOVLMCYUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5O2/c1-22-14-10-13(15(23-2)9-12(14)17)21-16(18-19-20-21)8-11-6-4-3-5-7-11/h3-7,9-10H,8,17H2,1-2H3.
What are the key properties of 4-(5-benzyltetrazol-1-yl)-2,5-dimethoxyaniline?
4-(5-benzyltetrazol-1-yl)-2,5-dimethoxyaniline has a molecular weight of 311.35 g/mol, XLogP of 1.85, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-benzyltetrazol-1-yl)-2,5-dimethoxyaniline is sourced from PubChem (CID 23019981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).