About (6,6-difluoro-5-methylhex-5-enyl) 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate
(6,6-difluoro-5-methylhex-5-enyl) 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 23020188) has the molecular formula C18H19F2NO2S
and a molecular weight of 351.42 g/mol. Its IUPAC name is (6,6-difluoro-5-methylhex-5-enyl) 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | (6,6-difluoro-5-methylhex-5-enyl) 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 23020188 |
| Molecular Formula | C18H19F2NO2S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (6,6-difluoro-5-methylhex-5-enyl) 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | CC(CCCCOC(=O)c1sc(-c2ccccc2)nc1C)=C(F)F |
| InChI | InChI=1S/C18H19F2NO2S/c1-12(16(19)20)8-6-7-11-23-18(22)15-13(2)21-17(24-15)14-9-4-3-5-10-14/h3-5,9-10H,6-8,11H2,1-2H3 |
| InChIKey | XYECCLYSNICXMV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (6,6-difluoro-5-methylhex-5-enyl) 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6,6-difluoro-5-methylhex-5-enyl) 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate?
The IUPAC name of (6,6-difluoro-5-methylhex-5-enyl) 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate (CID 23020188) is (6,6-difluoro-5-methylhex-5-enyl) 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for (6,6-difluoro-5-methylhex-5-enyl) 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for (6,6-difluoro-5-methylhex-5-enyl) 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate is CC(CCCCOC(=O)c1sc(-c2ccccc2)nc1C)=C(F)F.
What is the InChIKey of (6,6-difluoro-5-methylhex-5-enyl) 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate?
The InChIKey is XYECCLYSNICXMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F2NO2S/c1-12(16(19)20)8-6-7-11-23-18(22)15-13(2)21-17(24-15)14-9-4-3-5-10-14/h3-5,9-10H,6-8,11H2,1-2H3.
What are the key properties of (6,6-difluoro-5-methylhex-5-enyl) 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate?
(6,6-difluoro-5-methylhex-5-enyl) 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate has a molecular weight of 351.42 g/mol, XLogP of 5.62, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6,6-difluoro-5-methylhex-5-enyl) 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 23020188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).