About furan-2-carbaldehyde;nitromethane
furan-2-carbaldehyde;nitromethane (PubChem CID 23020378) has the molecular formula C6H7NO4
and a molecular weight of 157.12 g/mol. Its IUPAC name is furan-2-carbaldehyde;nitromethane.
Molecular Properties
| Compound Name | furan-2-carbaldehyde;nitromethane |
| PubChem CID | 23020378 |
| Molecular Formula | C6H7NO4 |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | furan-2-carbaldehyde;nitromethane |
| SMILES | C[N+](=O)[O-].O=Cc1ccco1 |
| InChI | InChI=1S/C5H4O2.CH3NO2/c6-4-5-2-1-3-7-5;1-2(3)4/h1-4H;1H3 |
| InChIKey | WLARYEOTKNDODS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 73.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze furan-2-carbaldehyde;nitromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-carbaldehyde;nitromethane?
The IUPAC name of furan-2-carbaldehyde;nitromethane (CID 23020378) is furan-2-carbaldehyde;nitromethane.
What is the SMILES notation for furan-2-carbaldehyde;nitromethane?
The canonical SMILES for furan-2-carbaldehyde;nitromethane is C[N+](=O)[O-].O=Cc1ccco1.
What is the InChIKey of furan-2-carbaldehyde;nitromethane?
The InChIKey is WLARYEOTKNDODS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O2.CH3NO2/c6-4-5-2-1-3-7-5;1-2(3)4/h1-4H;1H3.
What are the key properties of furan-2-carbaldehyde;nitromethane?
furan-2-carbaldehyde;nitromethane has a molecular weight of 157.12 g/mol, XLogP of 0.99, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-carbaldehyde;nitromethane is sourced from PubChem (CID 23020378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).