About trimethoxy(methyl)silane;3-trimethoxysilylpropane-1-thiol
trimethoxy(methyl)silane;3-trimethoxysilylpropane-1-thiol (PubChem CID 23020646) has the molecular formula C10H28O6SSi2
and a molecular weight of 332.57 g/mol. Its IUPAC name is trimethoxy(methyl)silane;3-trimethoxysilylpropane-1-thiol.
Molecular Properties
| Compound Name | trimethoxy(methyl)silane;3-trimethoxysilylpropane-1-thiol |
| PubChem CID | 23020646 |
| Molecular Formula | C10H28O6SSi2 |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | trimethoxy(methyl)silane;3-trimethoxysilylpropane-1-thiol |
| SMILES | CO[Si](C)(OC)OC.CO[Si](CCCS)(OC)OC |
| InChI | InChI=1S/C6H16O3SSi.C4H12O3Si/c1-7-11(8-2,9-3)6-4-5-10;1-5-8(4,6-2)7-3/h10H,4-6H2,1-3H3;1-4H3 |
| InChIKey | ZGKPZGIKZDCABI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze trimethoxy(methyl)silane;3-trimethoxysilylpropane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxy(methyl)silane;3-trimethoxysilylpropane-1-thiol?
The IUPAC name of trimethoxy(methyl)silane;3-trimethoxysilylpropane-1-thiol (CID 23020646) is trimethoxy(methyl)silane;3-trimethoxysilylpropane-1-thiol.
What is the SMILES notation for trimethoxy(methyl)silane;3-trimethoxysilylpropane-1-thiol?
The canonical SMILES for trimethoxy(methyl)silane;3-trimethoxysilylpropane-1-thiol is CO[Si](C)(OC)OC.CO[Si](CCCS)(OC)OC.
What is the InChIKey of trimethoxy(methyl)silane;3-trimethoxysilylpropane-1-thiol?
The InChIKey is ZGKPZGIKZDCABI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3SSi.C4H12O3Si/c1-7-11(8-2,9-3)6-4-5-10;1-5-8(4,6-2)7-3/h10H,4-6H2,1-3H3;1-4H3.
What are the key properties of trimethoxy(methyl)silane;3-trimethoxysilylpropane-1-thiol?
trimethoxy(methyl)silane;3-trimethoxysilylpropane-1-thiol has a molecular weight of 332.57 g/mol, XLogP of 1.68, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxy(methyl)silane;3-trimethoxysilylpropane-1-thiol is sourced from PubChem (CID 23020646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).