C25H22F3N3OS — CID 2302150
(2R)-2,5-bis(4-methylphenyl)-6-(4-methylphenyl)imino-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one (PubChem CID 2302150) has the molecular formula C25H22F3N3OS and a molecular weight of 469.53 g/mol. Its IUPAC name is (2R)-2,5-bis(4-methylphenyl)-6-(4-methylphenyl)imino-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one.
| Compound Name | (2R)-2,5-bis(4-methylphenyl)-6-(4-methylphenyl)imino-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one |
|---|---|
| PubChem CID | 2302150 |
| Molecular Formula | C25H22F3N3OS |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | (2R)-2,5-bis(4-methylphenyl)-6-(4-methylphenyl)imino-2-(trifluoromethyl)-1,3,5-thiadiazinan-4-one |
| SMILES | Cc1ccc(/N=C2\S[C@](c3ccc(C)cc3)(C(F)(F)F)NC(=O)N2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H22F3N3OS/c1-16-4-10-19(11-5-16)24(25(26,27)28)30-22(32)31(21-14-8-18(3)9-15-21)23(33-24)29-20-12-6-17(2)7-13-20/h4-15H,1-3H3,(H,30,32)/b29-23-/t24-/m1/s1 |
| InChIKey | MIZLJNIHANGSAC-KNQUJZAFSA-N |
| XLogP | 6.98 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|