About ethyl 2-[4-chloro-3-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]anilino]acetate
ethyl 2-[4-chloro-3-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]anilino]acetate (PubChem CID 23022253) has the molecular formula C22H23ClF2N2O3
and a molecular weight of 436.89 g/mol. Its IUPAC name is ethyl 2-[4-chloro-3-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]anilino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[4-chloro-3-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]anilino]acetate |
| PubChem CID | 23022253 |
| Molecular Formula | C22H23ClF2N2O3 |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | ethyl 2-[4-chloro-3-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]anilino]acetate |
| SMILES | CCOC(=O)CNc1ccc(Cl)c(N2CC(Cc3ccc(F)cc3F)CCC2=O)c1 |
| InChI | InChI=1S/C22H23ClF2N2O3/c1-2-30-22(29)12-26-17-6-7-18(23)20(11-17)27-13-14(3-8-21(27)28)9-15-4-5-16(24)10-19(15)25/h4-7,10-11,14,26H,2-3,8-9,12-13H2,1H3 |
| InChIKey | MXWYXYJNNHMJPK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[4-chloro-3-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]anilino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-chloro-3-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]anilino]acetate?
The IUPAC name of ethyl 2-[4-chloro-3-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]anilino]acetate (CID 23022253) is ethyl 2-[4-chloro-3-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]anilino]acetate.
What is the SMILES notation for ethyl 2-[4-chloro-3-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]anilino]acetate?
The canonical SMILES for ethyl 2-[4-chloro-3-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]anilino]acetate is CCOC(=O)CNc1ccc(Cl)c(N2CC(Cc3ccc(F)cc3F)CCC2=O)c1.
What is the InChIKey of ethyl 2-[4-chloro-3-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]anilino]acetate?
The InChIKey is MXWYXYJNNHMJPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23ClF2N2O3/c1-2-30-22(29)12-26-17-6-7-18(23)20(11-17)27-13-14(3-8-21(27)28)9-15-4-5-16(24)10-19(15)25/h4-7,10-11,14,26H,2-3,8-9,12-13H2,1H3.
What are the key properties of ethyl 2-[4-chloro-3-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]anilino]acetate?
ethyl 2-[4-chloro-3-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]anilino]acetate has a molecular weight of 436.89 g/mol, XLogP of 4.58, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-chloro-3-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]anilino]acetate is sourced from PubChem (CID 23022253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).