About N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-4-propan-2-ylaniline
N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-4-propan-2-ylaniline (PubChem CID 23022691) has the molecular formula C26H26N2O3
and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-4-propan-2-ylaniline.
Molecular Properties
| Compound Name | N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-4-propan-2-ylaniline |
| PubChem CID | 23022691 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-4-propan-2-ylaniline |
| SMILES | COc1cc2nccc(Oc3ccc(Nc4ccc(C(C)C)cc4)cc3)c2cc1OC |
| InChI | InChI=1S/C26H26N2O3/c1-17(2)18-5-7-19(8-6-18)28-20-9-11-21(12-10-20)31-24-13-14-27-23-16-26(30-4)25(29-3)15-22(23)24/h5-17,28H,1-4H3 |
| InChIKey | ZOZFANGNXJDGKY-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-4-propan-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-4-propan-2-ylaniline?
The IUPAC name of N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-4-propan-2-ylaniline (CID 23022691) is N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-4-propan-2-ylaniline.
What is the SMILES notation for N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-4-propan-2-ylaniline?
The canonical SMILES for N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-4-propan-2-ylaniline is COc1cc2nccc(Oc3ccc(Nc4ccc(C(C)C)cc4)cc3)c2cc1OC.
What is the InChIKey of N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-4-propan-2-ylaniline?
The InChIKey is ZOZFANGNXJDGKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N2O3/c1-17(2)18-5-7-19(8-6-18)28-20-9-11-21(12-10-20)31-24-13-14-27-23-16-26(30-4)25(29-3)15-22(23)24/h5-17,28H,1-4H3.
What are the key properties of N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-4-propan-2-ylaniline?
N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-4-propan-2-ylaniline has a molecular weight of 414.51 g/mol, XLogP of 6.91, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-4-propan-2-ylaniline is sourced from PubChem (CID 23022691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).