C32H24N2O15S2 — CID 23023009
[5-[2-(3,4-dimethoxyphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]oxy-1,3-dioxoisoindol-2-yl] 3,4-dimethoxybenzenesulfonate (PubChem CID 23023009) has the molecular formula C32H24N2O15S2 and a molecular weight of 740.68 g/mol. Its IUPAC name is [5-[2-(3,4-dimethoxyphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]oxy-1,3-dioxoisoindol-2-yl] 3,4-dimethoxybenzenesulfonate.
| Compound Name | [5-[2-(3,4-dimethoxyphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]oxy-1,3-dioxoisoindol-2-yl] 3,4-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 23023009 |
| Molecular Formula | C32H24N2O15S2 |
| Molecular Weight | 740.68 g/mol |
| Exact Mass | 740.06 |
| IUPAC Name | [5-[2-(3,4-dimethoxyphenyl)sulfonyloxy-1,3-dioxoisoindol-5-yl]oxy-1,3-dioxoisoindol-2-yl] 3,4-dimethoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)ON2C(=O)c3ccc(Oc4ccc5c(c4)C(=O)N(OS(=O)(=O)c4ccc(OC)c(OC)c4)C5=O)cc3C2=O)cc1OC |
| InChI | InChI=1S/C32H24N2O15S2/c1-43-25-11-7-19(15-27(25)45-3)50(39,40)48-33-29(35)21-9-5-17(13-23(21)31(33)37)47-18-6-10-22-24(14-18)32(38)34(30(22)36)49-51(41,42)20-8-12-26(44-2)28(16-20)46-4/h5-16H,1-4H3 |
| InChIKey | ALOPGWUKXJIHJT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 207.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.68 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|