About 4-oxo-2,3-dihydroquinazoline-1-carboxamide
4-oxo-2,3-dihydroquinazoline-1-carboxamide (PubChem CID 23023743) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is 4-oxo-2,3-dihydroquinazoline-1-carboxamide.
Molecular Properties
| Compound Name | 4-oxo-2,3-dihydroquinazoline-1-carboxamide |
| PubChem CID | 23023743 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 4-oxo-2,3-dihydroquinazoline-1-carboxamide |
| SMILES | NC(=O)N1CNC(=O)c2ccccc21 |
| InChI | InChI=1S/C9H9N3O2/c10-9(14)12-5-11-8(13)6-3-1-2-4-7(6)12/h1-4H,5H2,(H2,10,14)(H,11,13) |
| InChIKey | ZVANNKPUXCCDDF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-oxo-2,3-dihydroquinazoline-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-2,3-dihydroquinazoline-1-carboxamide?
The IUPAC name of 4-oxo-2,3-dihydroquinazoline-1-carboxamide (CID 23023743) is 4-oxo-2,3-dihydroquinazoline-1-carboxamide.
What is the SMILES notation for 4-oxo-2,3-dihydroquinazoline-1-carboxamide?
The canonical SMILES for 4-oxo-2,3-dihydroquinazoline-1-carboxamide is NC(=O)N1CNC(=O)c2ccccc21.
What is the InChIKey of 4-oxo-2,3-dihydroquinazoline-1-carboxamide?
The InChIKey is ZVANNKPUXCCDDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c10-9(14)12-5-11-8(13)6-3-1-2-4-7(6)12/h1-4H,5H2,(H2,10,14)(H,11,13).
What are the key properties of 4-oxo-2,3-dihydroquinazoline-1-carboxamide?
4-oxo-2,3-dihydroquinazoline-1-carboxamide has a molecular weight of 191.19 g/mol, XLogP of 0.27, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-2,3-dihydroquinazoline-1-carboxamide is sourced from PubChem (CID 23023743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).