About 4-(4-chlorophenyl)-2,5-dioxoimidazolidine-4-carboxamide
4-(4-chlorophenyl)-2,5-dioxoimidazolidine-4-carboxamide (PubChem CID 23023799) has the molecular formula C10H8ClN3O3
and a molecular weight of 253.65 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2,5-dioxoimidazolidine-4-carboxamide.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-2,5-dioxoimidazolidine-4-carboxamide |
| PubChem CID | 23023799 |
| Molecular Formula | C10H8ClN3O3 |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 4-(4-chlorophenyl)-2,5-dioxoimidazolidine-4-carboxamide |
| SMILES | NC(=O)C1(c2ccc(Cl)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C10H8ClN3O3/c11-6-3-1-5(2-4-6)10(7(12)15)8(16)13-9(17)14-10/h1-4H,(H2,12,15)(H2,13,14,16,17) |
| InChIKey | YNUOXBUXOPPCPL-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chlorophenyl)-2,5-dioxoimidazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-2,5-dioxoimidazolidine-4-carboxamide?
The IUPAC name of 4-(4-chlorophenyl)-2,5-dioxoimidazolidine-4-carboxamide (CID 23023799) is 4-(4-chlorophenyl)-2,5-dioxoimidazolidine-4-carboxamide.
What is the SMILES notation for 4-(4-chlorophenyl)-2,5-dioxoimidazolidine-4-carboxamide?
The canonical SMILES for 4-(4-chlorophenyl)-2,5-dioxoimidazolidine-4-carboxamide is NC(=O)C1(c2ccc(Cl)cc2)NC(=O)NC1=O.
What is the InChIKey of 4-(4-chlorophenyl)-2,5-dioxoimidazolidine-4-carboxamide?
The InChIKey is YNUOXBUXOPPCPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClN3O3/c11-6-3-1-5(2-4-6)10(7(12)15)8(16)13-9(17)14-10/h1-4H,(H2,12,15)(H2,13,14,16,17).
What are the key properties of 4-(4-chlorophenyl)-2,5-dioxoimidazolidine-4-carboxamide?
4-(4-chlorophenyl)-2,5-dioxoimidazolidine-4-carboxamide has a molecular weight of 253.65 g/mol, XLogP of -0.14, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-2,5-dioxoimidazolidine-4-carboxamide is sourced from PubChem (CID 23023799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).