5-amino-2-methyl-1,3-thiazole-4-carboxylic acid

C5H6N2O2S — CID 23023808

IUPAC5-amino-2-methyl-1,3-thiazole-4-carboxylic acid
SMILESCc1nc(C(=O)O)c(N)s1
InChIInChI=1S/C5H6N2O2S/c1-2-7-3(5(8)9)4(6)10-2/h6H2,1H3,(H,8,9)
InChIKeyUSZABUOLFPZBEV-UHFFFAOYSA-N
MW158.18 g/mol
LogP0.73
Rot. Bonds1

About 5-amino-2-methyl-1,3-thiazole-4-carboxylic acid

5-amino-2-methyl-1,3-thiazole-4-carboxylic acid (PubChem CID 23023808) has the molecular formula C5H6N2O2S and a molecular weight of 158.18 g/mol. Its IUPAC name is 5-amino-2-methyl-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-amino-2-methyl-1,3-thiazole-4-carboxylic acid
PubChem CID23023808
Molecular FormulaC5H6N2O2S
Molecular Weight158.18 g/mol
Exact Mass158.01
IUPAC Name5-amino-2-methyl-1,3-thiazole-4-carboxylic acid
SMILESCc1nc(C(=O)O)c(N)s1
InChIInChI=1S/C5H6N2O2S/c1-2-7-3(5(8)9)4(6)10-2/h6H2,1H3,(H,8,9)
InChIKeyUSZABUOLFPZBEV-UHFFFAOYSA-N
XLogP0.73
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.18
LogP ≤ 50.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-amino-2-methyl-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-2-methyl-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-amino-2-methyl-1,3-thiazole-4-carboxylic acid (CID 23023808) is 5-amino-2-methyl-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-amino-2-methyl-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-amino-2-methyl-1,3-thiazole-4-carboxylic acid is Cc1nc(C(=O)O)c(N)s1.
What is the InChIKey of 5-amino-2-methyl-1,3-thiazole-4-carboxylic acid?
The InChIKey is USZABUOLFPZBEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2S/c1-2-7-3(5(8)9)4(6)10-2/h6H2,1H3,(H,8,9).
What are the key properties of 5-amino-2-methyl-1,3-thiazole-4-carboxylic acid?
5-amino-2-methyl-1,3-thiazole-4-carboxylic acid has a molecular weight of 158.18 g/mol, XLogP of 0.73, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-methyl-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 23023808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).