C15H23N3O6 — CID 23024182
1-(2-hydroxyethyl)-3,5-bis(2-prop-2-enoxyethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 23024182) has the molecular formula C15H23N3O6 and a molecular weight of 341.36 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3,5-bis(2-prop-2-enoxyethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(2-hydroxyethyl)-3,5-bis(2-prop-2-enoxyethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 23024182 |
| Molecular Formula | C15H23N3O6 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-(2-hydroxyethyl)-3,5-bis(2-prop-2-enoxyethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCOCCn1c(=O)n(CCO)c(=O)n(CCOCC=C)c1=O |
| InChI | InChI=1S/C15H23N3O6/c1-3-9-23-11-6-17-13(20)16(5-8-19)14(21)18(15(17)22)7-12-24-10-4-2/h3-4,19H,1-2,5-12H2 |
| InChIKey | RATDPFKVNIVSND-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|