About (5-chloroimidazo[1,2-a]pyridin-2-yl)methanol
(5-chloroimidazo[1,2-a]pyridin-2-yl)methanol (PubChem CID 23024970) has the molecular formula C8H7ClN2O
and a molecular weight of 182.61 g/mol. Its IUPAC name is (5-chloroimidazo[1,2-a]pyridin-2-yl)methanol.
Molecular Properties
| Compound Name | (5-chloroimidazo[1,2-a]pyridin-2-yl)methanol |
| PubChem CID | 23024970 |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | (5-chloroimidazo[1,2-a]pyridin-2-yl)methanol |
| SMILES | OCc1cn2c(Cl)cccc2n1 |
| InChI | InChI=1S/C8H7ClN2O/c9-7-2-1-3-8-10-6(5-12)4-11(7)8/h1-4,12H,5H2 |
| InChIKey | HXNBPLVYJAUYEI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (5-chloroimidazo[1,2-a]pyridin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloroimidazo[1,2-a]pyridin-2-yl)methanol?
The IUPAC name of (5-chloroimidazo[1,2-a]pyridin-2-yl)methanol (CID 23024970) is (5-chloroimidazo[1,2-a]pyridin-2-yl)methanol.
What is the SMILES notation for (5-chloroimidazo[1,2-a]pyridin-2-yl)methanol?
The canonical SMILES for (5-chloroimidazo[1,2-a]pyridin-2-yl)methanol is OCc1cn2c(Cl)cccc2n1.
What is the InChIKey of (5-chloroimidazo[1,2-a]pyridin-2-yl)methanol?
The InChIKey is HXNBPLVYJAUYEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2O/c9-7-2-1-3-8-10-6(5-12)4-11(7)8/h1-4,12H,5H2.
What are the key properties of (5-chloroimidazo[1,2-a]pyridin-2-yl)methanol?
(5-chloroimidazo[1,2-a]pyridin-2-yl)methanol has a molecular weight of 182.61 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloroimidazo[1,2-a]pyridin-2-yl)methanol is sourced from PubChem (CID 23024970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).