About 2-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-1H-imidazo[4,5-b]pyridine
2-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-1H-imidazo[4,5-b]pyridine (PubChem CID 23025557) has the molecular formula C17H11N3O3
and a molecular weight of 305.29 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 23025557 |
| Molecular Formula | C17H11N3O3 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-1H-imidazo[4,5-b]pyridine |
| SMILES | c1coc(-c2cnc3nc(-c4ccc5c(c4)OCO5)[nH]c3c2)c1 |
| InChI | InChI=1S/C17H11N3O3/c1-2-13(21-5-1)11-6-12-17(18-8-11)20-16(19-12)10-3-4-14-15(7-10)23-9-22-14/h1-8H,9H2,(H,18,19,20) |
| InChIKey | ZBASVNYOWOJQGE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-1H-imidazo[4,5-b]pyridine (CID 23025557) is 2-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-1H-imidazo[4,5-b]pyridine is c1coc(-c2cnc3nc(-c4ccc5c(c4)OCO5)[nH]c3c2)c1.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-1H-imidazo[4,5-b]pyridine?
The InChIKey is ZBASVNYOWOJQGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N3O3/c1-2-13(21-5-1)11-6-12-17(18-8-11)20-16(19-12)10-3-4-14-15(7-10)23-9-22-14/h1-8H,9H2,(H,18,19,20).
What are the key properties of 2-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-1H-imidazo[4,5-b]pyridine?
2-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-1H-imidazo[4,5-b]pyridine has a molecular weight of 305.29 g/mol, XLogP of 3.61, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-6-(furan-2-yl)-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 23025557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).