About 2-[3,5-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazole
2-[3,5-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazole (PubChem CID 23025660) has the molecular formula C15H6BrF6NO
and a molecular weight of 410.11 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazole |
| PubChem CID | 23025660 |
| Molecular Formula | C15H6BrF6NO |
| Molecular Weight | 410.11 g/mol |
| Exact Mass | 408.95 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazole |
| SMILES | FC(F)(F)c1cc(-c2nc3ccc(Br)cc3o2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H6BrF6NO/c16-10-1-2-11-12(6-10)24-13(23-11)7-3-8(14(17,18)19)5-9(4-7)15(20,21)22/h1-6H |
| InChIKey | OHBLOIREBBCZNB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.11 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3,5-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazole?
The IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazole (CID 23025660) is 2-[3,5-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazole.
What is the SMILES notation for 2-[3,5-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazole?
The canonical SMILES for 2-[3,5-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazole is FC(F)(F)c1cc(-c2nc3ccc(Br)cc3o2)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[3,5-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazole?
The InChIKey is OHBLOIREBBCZNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H6BrF6NO/c16-10-1-2-11-12(6-10)24-13(23-11)7-3-8(14(17,18)19)5-9(4-7)15(20,21)22/h1-6H.
What are the key properties of 2-[3,5-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazole?
2-[3,5-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazole has a molecular weight of 410.11 g/mol, XLogP of 6.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazole is sourced from PubChem (CID 23025660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).