C6H8F6O3 — CID 23026182
3-(1,2,2,3,3,3-hexafluoropropoxy)propane-1,2-diol (PubChem CID 23026182) has the molecular formula C6H8F6O3 and a molecular weight of 242.12 g/mol. Its IUPAC name is 3-(1,2,2,3,3,3-hexafluoropropoxy)propane-1,2-diol.
| Compound Name | 3-(1,2,2,3,3,3-hexafluoropropoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 23026182 |
| Molecular Formula | C6H8F6O3 |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 3-(1,2,2,3,3,3-hexafluoropropoxy)propane-1,2-diol |
| SMILES | OCC(O)COC(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H8F6O3/c7-4(15-2-3(14)1-13)5(8,9)6(10,11)12/h3-4,13-14H,1-2H2 |
| InChIKey | JUSONDLSPMSRIO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|