C9H11F9O3 — CID 23026186
3-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)propane-1,2-diol (PubChem CID 23026186) has the molecular formula C9H11F9O3 and a molecular weight of 338.17 g/mol. Its IUPAC name is 3-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)propane-1,2-diol.
| Compound Name | 3-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 23026186 |
| Molecular Formula | C9H11F9O3 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 3-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)propane-1,2-diol |
| SMILES | OCC(O)COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F9O3/c10-6(11,1-2-21-4-5(20)3-19)7(12,13)8(14,15)9(16,17)18/h5,19-20H,1-4H2 |
| InChIKey | UUPQLJUUKYLIEW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|