About ethyl(dimethyl)oxidanium
ethyl(dimethyl)oxidanium (PubChem CID 23026364) has the molecular formula C4H11O+
and a molecular weight of 75.13 g/mol. Its IUPAC name is ethyl(dimethyl)oxidanium.
Molecular Properties
| Compound Name | ethyl(dimethyl)oxidanium |
| PubChem CID | 23026364 |
| Molecular Formula | C4H11O+ |
| Molecular Weight | 75.13 g/mol |
| Exact Mass | 75.08 |
| IUPAC Name | ethyl(dimethyl)oxidanium |
| SMILES | CC[O+](C)C |
| InChI | InChI=1S/C4H11O/c1-4-5(2)3/h4H2,1-3H3/q+1 |
| InChIKey | LNXKLBNNZGWGBD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 2.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 75.13 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze ethyl(dimethyl)oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(dimethyl)oxidanium?
The IUPAC name of ethyl(dimethyl)oxidanium (CID 23026364) is ethyl(dimethyl)oxidanium.
What is the SMILES notation for ethyl(dimethyl)oxidanium?
The canonical SMILES for ethyl(dimethyl)oxidanium is CC[O+](C)C.
What is the InChIKey of ethyl(dimethyl)oxidanium?
The InChIKey is LNXKLBNNZGWGBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11O/c1-4-5(2)3/h4H2,1-3H3/q+1.
What are the key properties of ethyl(dimethyl)oxidanium?
ethyl(dimethyl)oxidanium has a molecular weight of 75.13 g/mol, XLogP of 0.82, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(dimethyl)oxidanium is sourced from PubChem (CID 23026364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).