C32H28O8 — CID 23026439
3,5,7-tris(phenoxycarbonyl)adamantane-1-carboxylic acid (PubChem CID 23026439) has the molecular formula C32H28O8 and a molecular weight of 540.57 g/mol. Its IUPAC name is 3,5,7-tris(phenoxycarbonyl)adamantane-1-carboxylic acid.
| Compound Name | 3,5,7-tris(phenoxycarbonyl)adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 23026439 |
| Molecular Formula | C32H28O8 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 3,5,7-tris(phenoxycarbonyl)adamantane-1-carboxylic acid |
| SMILES | O=C(O)C12CC3(C(=O)Oc4ccccc4)CC(C(=O)Oc4ccccc4)(C1)CC(C(=O)Oc1ccccc1)(C2)C3 |
| InChI | InChI=1S/C32H28O8/c33-25(34)29-16-30(26(35)38-22-10-4-1-5-11-22)19-31(17-29,27(36)39-23-12-6-2-7-13-23)21-32(18-29,20-30)28(37)40-24-14-8-3-9-15-24/h1-15H,16-21H2,(H,33,34) |
| InChIKey | AHVBDCQNYXWGQQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|