About [4-[[4-(dimethylamino)-5,6-dimethylpyrimidin-2-yl]amino]cyclohexyl]carbamic acid
[4-[[4-(dimethylamino)-5,6-dimethylpyrimidin-2-yl]amino]cyclohexyl]carbamic acid (PubChem CID 23027177) has the molecular formula C15H25N5O2
and a molecular weight of 307.40 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)-5,6-dimethylpyrimidin-2-yl]amino]cyclohexyl]carbamic acid.
Molecular Properties
| Compound Name | [4-[[4-(dimethylamino)-5,6-dimethylpyrimidin-2-yl]amino]cyclohexyl]carbamic acid |
| PubChem CID | 23027177 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | [4-[[4-(dimethylamino)-5,6-dimethylpyrimidin-2-yl]amino]cyclohexyl]carbamic acid |
| SMILES | Cc1nc(NC2CCC(NC(=O)O)CC2)nc(N(C)C)c1C |
| InChI | InChI=1S/C15H25N5O2/c1-9-10(2)16-14(19-13(9)20(3)4)17-11-5-7-12(8-6-11)18-15(21)22/h11-12,18H,5-8H2,1-4H3,(H,21,22)(H,16,17,19) |
| InChIKey | NQXUPJAODSPXEN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[[4-(dimethylamino)-5,6-dimethylpyrimidin-2-yl]amino]cyclohexyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[4-(dimethylamino)-5,6-dimethylpyrimidin-2-yl]amino]cyclohexyl]carbamic acid?
The IUPAC name of [4-[[4-(dimethylamino)-5,6-dimethylpyrimidin-2-yl]amino]cyclohexyl]carbamic acid (CID 23027177) is [4-[[4-(dimethylamino)-5,6-dimethylpyrimidin-2-yl]amino]cyclohexyl]carbamic acid.
What is the SMILES notation for [4-[[4-(dimethylamino)-5,6-dimethylpyrimidin-2-yl]amino]cyclohexyl]carbamic acid?
The canonical SMILES for [4-[[4-(dimethylamino)-5,6-dimethylpyrimidin-2-yl]amino]cyclohexyl]carbamic acid is Cc1nc(NC2CCC(NC(=O)O)CC2)nc(N(C)C)c1C.
What is the InChIKey of [4-[[4-(dimethylamino)-5,6-dimethylpyrimidin-2-yl]amino]cyclohexyl]carbamic acid?
The InChIKey is NQXUPJAODSPXEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N5O2/c1-9-10(2)16-14(19-13(9)20(3)4)17-11-5-7-12(8-6-11)18-15(21)22/h11-12,18H,5-8H2,1-4H3,(H,21,22)(H,16,17,19).
What are the key properties of [4-[[4-(dimethylamino)-5,6-dimethylpyrimidin-2-yl]amino]cyclohexyl]carbamic acid?
[4-[[4-(dimethylamino)-5,6-dimethylpyrimidin-2-yl]amino]cyclohexyl]carbamic acid has a molecular weight of 307.40 g/mol, XLogP of 2.15, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[4-(dimethylamino)-5,6-dimethylpyrimidin-2-yl]amino]cyclohexyl]carbamic acid is sourced from PubChem (CID 23027177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).