C15H22Cl3N5O2 — CID 23027370
[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-(2,2,2-trichloroethyl)carbamic acid (PubChem CID 23027370) has the molecular formula C15H22Cl3N5O2 and a molecular weight of 410.73 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-(2,2,2-trichloroethyl)carbamic acid.
| Compound Name | [4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-(2,2,2-trichloroethyl)carbamic acid |
|---|---|
| PubChem CID | 23027370 |
| Molecular Formula | C15H22Cl3N5O2 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | [4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-(2,2,2-trichloroethyl)carbamic acid |
| SMILES | CN(C)c1ccnc(NC2CCC(N(CC(Cl)(Cl)Cl)C(=O)O)CC2)n1 |
| InChI | InChI=1S/C15H22Cl3N5O2/c1-22(2)12-7-8-19-13(21-12)20-10-3-5-11(6-4-10)23(14(24)25)9-15(16,17)18/h7-8,10-11H,3-6,9H2,1-2H3,(H,24,25)(H,19,20,21) |
| InChIKey | IZUINUUQWINPMT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|