C21H26N6O3 — CID 23027745
(E)-N-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 23027745) has the molecular formula C21H26N6O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is (E)-N-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 23027745 |
| Molecular Formula | C21H26N6O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (E)-N-[4-[[4-(dimethylamino)pyrimidin-2-yl]amino]cyclohexyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | CN(C)c1ccnc(NC2CCC(NC(=O)/C=C/c3cccc([N+](=O)[O-])c3)CC2)n1 |
| InChI | InChI=1S/C21H26N6O3/c1-26(2)19-12-13-22-21(25-19)24-17-9-7-16(8-10-17)23-20(28)11-6-15-4-3-5-18(14-15)27(29)30/h3-6,11-14,16-17H,7-10H2,1-2H3,(H,23,28)(H,22,24,25)/b11-6+ |
| InChIKey | YBLYPVMFFUFJKQ-IZZDOVSWSA-N |
| XLogP | 3.00 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|