About [2-(1,3-oxazol-2-yl)phenyl]thiourea
[2-(1,3-oxazol-2-yl)phenyl]thiourea (PubChem CID 23027895) has the molecular formula C10H9N3OS
and a molecular weight of 219.27 g/mol. Its IUPAC name is [2-(1,3-oxazol-2-yl)phenyl]thiourea.
Molecular Properties
| Compound Name | [2-(1,3-oxazol-2-yl)phenyl]thiourea |
| PubChem CID | 23027895 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | [2-(1,3-oxazol-2-yl)phenyl]thiourea |
| SMILES | NC(=S)Nc1ccccc1-c1ncco1 |
| InChI | InChI=1S/C10H9N3OS/c11-10(15)13-8-4-2-1-3-7(8)9-12-5-6-14-9/h1-6H,(H3,11,13,15) |
| InChIKey | RWQHAMXUWRDHHB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,3-oxazol-2-yl)phenyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-oxazol-2-yl)phenyl]thiourea?
The IUPAC name of [2-(1,3-oxazol-2-yl)phenyl]thiourea (CID 23027895) is [2-(1,3-oxazol-2-yl)phenyl]thiourea.
What is the SMILES notation for [2-(1,3-oxazol-2-yl)phenyl]thiourea?
The canonical SMILES for [2-(1,3-oxazol-2-yl)phenyl]thiourea is NC(=S)Nc1ccccc1-c1ncco1.
What is the InChIKey of [2-(1,3-oxazol-2-yl)phenyl]thiourea?
The InChIKey is RWQHAMXUWRDHHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3OS/c11-10(15)13-8-4-2-1-3-7(8)9-12-5-6-14-9/h1-6H,(H3,11,13,15).
What are the key properties of [2-(1,3-oxazol-2-yl)phenyl]thiourea?
[2-(1,3-oxazol-2-yl)phenyl]thiourea has a molecular weight of 219.27 g/mol, XLogP of 2.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-oxazol-2-yl)phenyl]thiourea is sourced from PubChem (CID 23027895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).