About N-(2,6-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine
N-(2,6-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 2302876) has the molecular formula C10H10Cl2N2
and a molecular weight of 229.11 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine.
Molecular Properties
| Compound Name | N-(2,6-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine |
| PubChem CID | 2302876 |
| Molecular Formula | C10H10Cl2N2 |
| Molecular Weight | 229.11 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | N-(2,6-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | Clc1cccc(Cl)c1NC1=NCCC1 |
| InChI | InChI=1S/C10H10Cl2N2/c11-7-3-1-4-8(12)10(7)14-9-5-2-6-13-9/h1,3-4H,2,5-6H2,(H,13,14) |
| InChIKey | ZBALZMHKFBREEV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.11 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,6-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine?
The IUPAC name of N-(2,6-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine (CID 2302876) is N-(2,6-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine.
What is the SMILES notation for N-(2,6-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine?
The canonical SMILES for N-(2,6-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine is Clc1cccc(Cl)c1NC1=NCCC1.
What is the InChIKey of N-(2,6-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine?
The InChIKey is ZBALZMHKFBREEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2N2/c11-7-3-1-4-8(12)10(7)14-9-5-2-6-13-9/h1,3-4H,2,5-6H2,(H,13,14).
What are the key properties of N-(2,6-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine?
N-(2,6-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine has a molecular weight of 229.11 g/mol, XLogP of 3.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dichlorophenyl)-3,4-dihydro-2H-pyrrol-5-amine is sourced from PubChem (CID 2302876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).