About (2,5-difluorophenyl)methyl piperidine-1-carboxylate
(2,5-difluorophenyl)methyl piperidine-1-carboxylate (PubChem CID 23028763) has the molecular formula C13H15F2NO2
and a molecular weight of 255.26 g/mol. Its IUPAC name is (2,5-difluorophenyl)methyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (2,5-difluorophenyl)methyl piperidine-1-carboxylate |
| PubChem CID | 23028763 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (2,5-difluorophenyl)methyl piperidine-1-carboxylate |
| SMILES | O=C(OCc1cc(F)ccc1F)N1CCCCC1 |
| InChI | InChI=1S/C13H15F2NO2/c14-11-4-5-12(15)10(8-11)9-18-13(17)16-6-2-1-3-7-16/h4-5,8H,1-3,6-7,9H2 |
| InChIKey | FEXBBGKMBHYKGF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,5-difluorophenyl)methyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-difluorophenyl)methyl piperidine-1-carboxylate?
The IUPAC name of (2,5-difluorophenyl)methyl piperidine-1-carboxylate (CID 23028763) is (2,5-difluorophenyl)methyl piperidine-1-carboxylate.
What is the SMILES notation for (2,5-difluorophenyl)methyl piperidine-1-carboxylate?
The canonical SMILES for (2,5-difluorophenyl)methyl piperidine-1-carboxylate is O=C(OCc1cc(F)ccc1F)N1CCCCC1.
What is the InChIKey of (2,5-difluorophenyl)methyl piperidine-1-carboxylate?
The InChIKey is FEXBBGKMBHYKGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO2/c14-11-4-5-12(15)10(8-11)9-18-13(17)16-6-2-1-3-7-16/h4-5,8H,1-3,6-7,9H2.
What are the key properties of (2,5-difluorophenyl)methyl piperidine-1-carboxylate?
(2,5-difluorophenyl)methyl piperidine-1-carboxylate has a molecular weight of 255.26 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-difluorophenyl)methyl piperidine-1-carboxylate is sourced from PubChem (CID 23028763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).