About 1-benzyl-2,5-dimethyl-3-(4-nitrophenyl)pyrrole
1-benzyl-2,5-dimethyl-3-(4-nitrophenyl)pyrrole (PubChem CID 23030352) has the molecular formula C19H18N2O2
and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-benzyl-2,5-dimethyl-3-(4-nitrophenyl)pyrrole.
Molecular Properties
| Compound Name | 1-benzyl-2,5-dimethyl-3-(4-nitrophenyl)pyrrole |
| PubChem CID | 23030352 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-benzyl-2,5-dimethyl-3-(4-nitrophenyl)pyrrole |
| SMILES | Cc1cc(-c2ccc([N+](=O)[O-])cc2)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C19H18N2O2/c1-14-12-19(17-8-10-18(11-9-17)21(22)23)15(2)20(14)13-16-6-4-3-5-7-16/h3-12H,13H2,1-2H3 |
| InChIKey | CVDJDRAWVYKTHO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2,5-dimethyl-3-(4-nitrophenyl)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2,5-dimethyl-3-(4-nitrophenyl)pyrrole?
The IUPAC name of 1-benzyl-2,5-dimethyl-3-(4-nitrophenyl)pyrrole (CID 23030352) is 1-benzyl-2,5-dimethyl-3-(4-nitrophenyl)pyrrole.
What is the SMILES notation for 1-benzyl-2,5-dimethyl-3-(4-nitrophenyl)pyrrole?
The canonical SMILES for 1-benzyl-2,5-dimethyl-3-(4-nitrophenyl)pyrrole is Cc1cc(-c2ccc([N+](=O)[O-])cc2)c(C)n1Cc1ccccc1.
What is the InChIKey of 1-benzyl-2,5-dimethyl-3-(4-nitrophenyl)pyrrole?
The InChIKey is CVDJDRAWVYKTHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2/c1-14-12-19(17-8-10-18(11-9-17)21(22)23)15(2)20(14)13-16-6-4-3-5-7-16/h3-12H,13H2,1-2H3.
What are the key properties of 1-benzyl-2,5-dimethyl-3-(4-nitrophenyl)pyrrole?
1-benzyl-2,5-dimethyl-3-(4-nitrophenyl)pyrrole has a molecular weight of 306.37 g/mol, XLogP of 4.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2,5-dimethyl-3-(4-nitrophenyl)pyrrole is sourced from PubChem (CID 23030352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).