About 4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidine;hydrochloride
4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidine;hydrochloride (PubChem CID 23031012) has the molecular formula C14H25ClN4
and a molecular weight of 284.83 g/mol. Its IUPAC name is 4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidine;hydrochloride.
Molecular Properties
| Compound Name | 4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidine;hydrochloride |
| PubChem CID | 23031012 |
| Molecular Formula | C14H25ClN4 |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidine;hydrochloride |
| SMILES | Cl.c1ncn(CC2(C3CCCCC3)CCNCC2)n1 |
| InChI | InChI=1S/C14H24N4.ClH/c1-2-4-13(5-3-1)14(6-8-15-9-7-14)10-18-12-16-11-17-18;/h11-13,15H,1-10H2;1H |
| InChIKey | GRVRDHZQAKAMPA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidine;hydrochloride?
The IUPAC name of 4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidine;hydrochloride (CID 23031012) is 4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidine;hydrochloride.
What is the SMILES notation for 4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidine;hydrochloride?
The canonical SMILES for 4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidine;hydrochloride is Cl.c1ncn(CC2(C3CCCCC3)CCNCC2)n1.
What is the InChIKey of 4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidine;hydrochloride?
The InChIKey is GRVRDHZQAKAMPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4.ClH/c1-2-4-13(5-3-1)14(6-8-15-9-7-14)10-18-12-16-11-17-18;/h11-13,15H,1-10H2;1H.
What are the key properties of 4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidine;hydrochloride?
4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidine;hydrochloride has a molecular weight of 284.83 g/mol, XLogP of 2.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidine;hydrochloride is sourced from PubChem (CID 23031012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).